| Identification | |
| Name: | Benzaldehyde,3-(difluoromethoxy)- |
| Synonyms: | m-(Difluoromethoxy)benzaldehyde; |
| CAS: | 85684-61-3 |
| Molecular Formula: | C8H6F2O2 |
| Molecular Weight: | 172.13 |
| InChI: | InChI=1/C8H6F2O2/c9-8(10)12-7-3-1-2-6(4-7)5-11/h1-5,8H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 107 °C |
| Density: | 1.300 |
| Refractive index: | n20/D 1.496(lit.) |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 107 °C |
| Storage Temperature: | Room temperature. |
| Sensitive: | Air Sensitive |
| Safety Data | |
 |
|
