Identification |
Name: | Benzaldehyde,3-(difluoromethoxy)- |
Synonyms: | m-(Difluoromethoxy)benzaldehyde; |
CAS: | 85684-61-3 |
Molecular Formula: | C8H6F2O2 |
Molecular Weight: | 172.13 |
InChI: | InChI=1/C8H6F2O2/c9-8(10)12-7-3-1-2-6(4-7)5-11/h1-5,8H |
Molecular Structure: |
|
Properties |
Flash Point: | 107 °C |
Density: | 1.300 |
Refractive index: | n20/D 1.496(lit.) |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | 107 °C |
Storage Temperature: | Room temperature. |
Sensitive: | Air Sensitive |
Safety Data |
|
|