| Identification | |
| Name: | 5H-Dibenz[b,f]azepine-5-carboxamide,hydrate (1:2) |
| Synonyms: | 5H-Dibenz[b,f]azepine-5-carboxamide,dihydrate (9CI); Carbamazepine dihydrate |
| CAS: | 85756-57-6 |
| Molecular Formula: | C15H12 N2 O . 2 H2 O |
| Molecular Weight: | 272.2991 |
| InChI: | InChI=1/C15H12N2O.2H2O/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17;;/h1-10H,(H2,16,18);2*1H2 |
| Molecular Structure: | ![(C15H12N2O.2H2O) 5H-Dibenz[b,f]azepine-5-carboxamide,dihydrate (9CI); Carbamazepine dihydrate](https://img1.guidechem.com/chem/e/dict/14/85756-57-6.jpg) |
| Properties | |
| Melting Point: | 190.2 deg C |
| Flash Point: | 202.4°C |
| Boiling Point: | 411°C at 760 mmHg |
| Solubility: | Sol in alcohol, acetone, propylene glycol; practically insol in water Soluble in chloroform, dimethylformamide, ethylene glycol monomethyl ether, or methanol; only slightly soluble in ethanol or glacial acetic acid In water, 18 mg/L at 25 deg C (est) |
| Flash Point: | 202.4°C |
| Color: | Crystals from absolute ethanol and benzene White to off-white powder |
| Safety Data | |
 |
|
