Identification |
Name: | 2-Pyridinepropanamine, g-(4-bromophenyl)-N,N-dimethyl- |
CAS: | 86-22-6 |
EINECS: | 201-657-8 |
Molecular Formula: | C16H19 Br N2 |
Molecular Weight: | 319.24 |
InChI: | InChI=1/C16H19BrN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3 |
Molecular Structure: |
|
Properties |
Density: | 1.265 g/cm3 |
Stability: | Sensitive to light maleate. |
Refractive index: | 1.577 |
Solubility: | Insoluble |
Appearance: | Oily liquid with slightly yellow color. Characteristic amine-like. |
Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
Color: | Oily liquid with slightly yellow color |
Usage: | Medication. |
Safety Data |
|
|