| Identification | |
| Name: | 2-Pyridinepropanamine, g-(4-bromophenyl)-N,N-dimethyl- |
| CAS: | 86-22-6 |
| EINECS: | 201-657-8 |
| Molecular Formula: | C16H19 Br N2 |
| Molecular Weight: | 319.24 |
| InChI: | InChI=1/C16H19BrN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3 |
| Molecular Structure: | ![(C16H19BrN2) Pyridine,2-[p-bromo-a-[2-(dimethylamino)ethyl]benzyl]-(6CI,7CI,8CI); (?à)-Brompheniramine;1-(p-Brom...](https://img1.guidechem.com/chem/e/dict/30/86-22-6.jpg) |
| Properties | |
| Density: | 1.265 g/cm3 |
| Stability: | Sensitive to light maleate. |
| Refractive index: | 1.577 |
| Solubility: | Insoluble |
| Appearance: | Oily liquid with slightly yellow color. Characteristic amine-like. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Oily liquid with slightly yellow color |
| Usage: | Medication. |
| Safety Data | |
 |
|
