| Identification | |
| Synonyms: | Alpha-naphthylcarbylamine; alpha-Naphthyl isocyanate; 1-Naphthyl isocyanate |
| CAS: | 86-84-0 |
| EINECS: | 201-703-7 |
| Molecular Formula: | C11H7NO |
| Molecular Weight: | 169.18 |
| InChI: | InChI=1/C11H7NO/c13-8-12-11-7-3-5-9-4-1-2-6-10(9)11/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2206 |
| Density: | 1.18 |
| Stability: | Stable. Incompatible with strong oxidizing agents, alcohols. |
| Refractive index: | 1.6324-1.6344 |
| Water Solubility: | negligible in water |
| Solubility: | negligible in water |
| Appearance: | colourless or slightly yellow liquid |
| Specification: |
Naphthalene,1-isocyanato- , its cas register number is 86-84-0. It also can be called alpha-Naphthyl isocyanate ; 1-Isocyanatonaphthalene ; 1-Naphthyl isocyanate ; Isocyanic acid, 1-naphthyl ester (8CI) .It is a colourless or slightly yellow liquid. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Storage under a nitrogen blanket has been recommended. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
