| Identification | |
| Name: | 1-Naphthylacetamide |
| Synonyms: | a-Naphthaleneacetamide;a-Naphthylacetamide;2-(1-Naphthyl)acetamide;Amid-Thin;Amid-Thin W;Diramid;Dirigol N;Frufix;NAAm;NSC 34862;Rootone;a-NAA amide; |
| CAS: | 86-86-2 |
| EINECS: | 201-704-2 |
| Molecular Formula: | C12H11N O |
| Molecular Weight: | 185.22 |
| InChI: | InChI=1/C12H11NO/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H2,13,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.178 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.648 |
| Water Solubility: | SOLVENT |
| Solubility: | SOLVENT |
| Appearance: | off white crystals |
| Specification: |
?1-Naphthylacetamide , its CAS NO. is 86-86-2, the synonyms are 1-Naphthylamine, N-acetyl- ; 2-(1-naphthyl)ethanamide ; alpha-naaamide ; Amid kyseliny 1-naftyloctove ; alpha-Naphthaleneacetic acid amide ; alpha-Naphthylacetamide . |
| Report: |
Reported in EPA TSCA Inventory. |
| Usage: | Plant growth regulator. |
| Safety Data | |
| Hazard Symbols | |
 |
|
