| Identification | |
| Name: | Naphthaleneacetic Acid |
| CAS: | 86-87-3 |
| EINECS: | 201-705-8 |
| Molecular Formula: | C12H10O2 |
| Molecular Weight: | 186.21 |
| InChI: | InChI=1/C12H10O2/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | >100oC |
| Boiling Point: | 352 |
| Density: | 1.263 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | 420 mg/L at 20ºC |
| Solubility: | 420 mg/L at 20oC |
| Appearance: | white to off white crystals |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29163900 |
| Flash Point: | >100oC |
| Color: | light yellow |
| Usage: | Herbicide. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
