| Identification | |
| Name: | 4-Bromophthalic anhydride |
| Synonyms: | Phthalicanhydride, 4-bromo- (6CI,7CI,8CI);4-Bromo-1,2-benzenedicarboxylic anhydride;5-Bromo-1,3-isobenzofurandione;1,3-Isobenzofurandione,5-bromo-; |
| CAS: | 86-90-8 |
| EINECS: | 201-707-9 |
| Molecular Formula: | C8H3BrO3 |
| Molecular Weight: | 227.01 |
| InChI: | InChI=1/C8H3BrO3/c9-4-1-2-5-6(3-4)8(11)12-7(5)10/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.911g/cm3 |
| Refractive index: | 1.651 |
| Appearance: | off-white to white powder |
| Specification: |
4-Bromophthalic anhydride , with CAS number of 86-90-8, can be called 4-Bromophthalic acid anhydride ; 1,3-Isobenzofurandione,5-bromo- ; Timtec-bb sbb008534 ; 5-Bromo-1,3-isobenzofurandione ; 4-Bromo-1,2-benzenedicarboxylic anhydride . It is an off-white to white powder. |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
