| Identification |
| Name: | 1-Phenyl-1H-tetrazole-5-thiol |
| Synonyms: | 1-Phenyl-5-mercaptotetrazole; 5-Mercapto-1-phenyltetrazole; Phenyltetrazolethiol; 5-Mercapto-1-phenyl-1H-tetrazole; 1-Phenyl-5-merkapto-1H-tetrazole; 1-Phenyl-5-mercapto-1H-tetrazole; 1-Phenyl-1H-1,2,3,4-tetrazole-5-thiol; PMT |
| CAS: | 86-93-1 |
| EINECS: | 201-710-5 |
| Molecular Formula: | C7H6N4S |
| Molecular Weight: | 178.21 |
| InChI: | InChI=1/C7H6N4S/c12-7-8-9-10-11(7)6-4-2-1-3-5-6/h1-5H,(H,8,10,12) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1325 |
| Flash Point: | 138°C |
| Boiling Point: | 340.2°C at 760 mmHg |
| Density: | 1.46g/cm3 |
| Stability: | Unstable. |
| Refractive index: | 1.76 |
| Appearance: | White solid. |
| Packinggroup: | III |
| HS Code: | 29339990 |
| Flash Point: | 138°C |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
