| Identification | |
| Name: | Butanoic acid,4-chloro-3-hydroxy-, methyl ester, (3S)- |
| Synonyms: | Butanoicacid, 4-chloro-3-hydroxy-, methyl ester, (S)-;Methyl(S)-4-chloro-3-hydroxybutyrate;butanoic acid, 4-chloro-3-hydroxy-, methyl ester, (3S)-; |
| CAS: | 86728-93-0 |
| Molecular Formula: | C5H9ClO3 |
| Molecular Weight: | 152.58 |
| InChI: | InChI=1/C5H9ClO3/c1-9-5(8)2-4(7)3-6/h4,7H,2-3H2,1H3/t4-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.232 g/cm3 |
| Refractive index: | 1.45 |
| Specification: |
The (S)-Methyl 4-cloro-3-hydroxybutyrate, with the CAS registry number 86728-93-0, has the systematic name of methyl (3S)-4-chloro-3-hydroxybutanoate. It belongs to the product category of API intermediates. And the molecular formula of the chemical is C5H9ClO3. The characteristics of this chemical are as followings: (1)ACD/LogP: -0.20; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.2; (4)ACD/LogD (pH 7.4): -0.2; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 18.54; (8)ACD/KOC (pH 7.4): 18.54; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 35.53 Å2; (13)Index of Refraction: 1.45; (14)Molar Refractivity: 33.33 cm3; (15)Molar Volume: 123.8 cm3; (16)Polarizability: 13.21×10-24cm3; (17)Surface Tension: 38.4 dyne/cm; (18)Density: 1.232 g/cm3; (19)Flash Point: 104.2 °C; (20)Enthalpy of Vaporization: 56.45 kJ/mol; (21)Boiling Point: 248.6 °C at 760 mmHg; (22)Vapour Pressure: 0.00387 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
