| Identification | |
| Name: | Phosphonic acid,dimethyl ester |
| Synonyms: | Dimethoxyphosphineoxide;Dimethyl acid phosphite;Dimethyl hydrogen phosphite;Dimethyl hydrogenphosphonate;Dimethyl phosphite;Dimethyl phosphonate;Hydrogen dimethylphosphite;Methyl phosphonate ((MeO)2HPO); |
| CAS: | 868-85-9 |
| EINECS: | 212-783-8 |
| Molecular Formula: | C2H7O3P |
| Molecular Weight: | 110.05 |
| InChI: | InChI=1/C2H7O3P/c1-4-6(3)5-2/h6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1992 |
| Flash Point: | 85? |
| Density: | 1.2 |
| Stability: | Stable. Moisture sensitive. Incompatible with water, strong oxidizing agents, acid chlorides, strong bases. |
| Refractive index: | 1.402 |
| Solubility: | soluble |
| Appearance: | colourless liquid |
| Packinggroup: | III |
| Flash Point: | 85? |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Color: | Mobile, colorless liquid |
| Usage: | Lubricant additives, intermediate, adhesive. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
