Identification |
Name: | Phosphonic acid,dimethyl ester |
Synonyms: | Dimethoxyphosphineoxide;Dimethyl acid phosphite;Dimethyl hydrogen phosphite;Dimethyl hydrogenphosphonate;Dimethyl phosphite;Dimethyl phosphonate;Hydrogen dimethylphosphite;Methyl phosphonate ((MeO)2HPO); |
CAS: | 868-85-9 |
EINECS: | 212-783-8 |
Molecular Formula: | C2H7O3P |
Molecular Weight: | 110.05 |
InChI: | InChI=1/C2H7O3P/c1-4-6(3)5-2/h6H,1-2H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 1992 |
Flash Point: | 85? |
Density: | 1.2 |
Stability: | Stable. Moisture sensitive. Incompatible with water, strong oxidizing agents, acid chlorides, strong bases. |
Refractive index: | 1.402 |
Solubility: | soluble |
Appearance: | colourless liquid |
Packinggroup: | III |
Flash Point: | 85? |
Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. Store protected from moisture. |
Sensitive: | Moisture Sensitive |
Color: | Mobile, colorless liquid |
Usage: | Lubricant additives, intermediate, adhesive. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|