| Identification |
| Name: | L-Leucine, glycyl- |
| Synonyms: | L-Leucine,N-glycyl-;Leucine, N-glycyl-, L- (8CI);Glycyl-L-leucine;Glycylleucine;NSC 83257;H-Gly-Leu-OH; |
| CAS: | 869-19-2 |
| EINECS: | 212-785-9 |
| Molecular Formula: | C8H16N2O3 |
| Molecular Weight: | 188.23 |
| InChI: | InChI=1/C8H16N2O3/c1-5(2)3-6(8(12)13)10-7(11)4-9/h5-6H,3-4,9H2,1-2H3,(H,10,11)(H,12,13)/t6-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.136 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | -35 ° (C=2, H2O) |
| Alpha: | -34.5 º (C=2, H2O) |
| Appearance: | light green - fine Crystalline powder |
| Storage Temperature: | −20°C |
| Usage: | Substrate for the assay of glycyl-L-leucine dipeptidase |
| Safety Data |
| |
 |
