| Identification |
| Name: | 1(3H)-Isobenzofuranone |
| Synonyms: | Phthalolactone;Phthalide(6CI,8CI);1-Phthalanone;2-Benzofuran-1(3H)-one;2-Hydroxymethylbenzoic acid g-lactone;3H-Isobenzofuran-1-one;NSC 1469; |
| CAS: | 87-41-2 |
| EINECS: | 201-744-0 |
| Molecular Formula: | C8H6O2 |
| Molecular Weight: | 134.13 |
| InChI: | InChI=1/C8H6O2/c9-8-7-4-2-1-3-6(7)5-10-8/h1-4H,5H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.264 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5302 (99.1 C) |
| Water Solubility: | sparingly soluble |
| Solubility: | sparingly soluble in water |
| Appearance: | White to Off-White Crystalline Powder |
| HS Code: | 29322980 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
