| Identification |
| Name: | 5-Bromoisatin monohydrate |
| Synonyms: | 5-bromoindoline-2,3-dione; 5-Bromoisatine; 5-bromo-1H-indole-2,3-dione; 5-Bromoisatin |
| CAS: | 87-48-9 |
| EINECS: | 201-747-7 |
| Molecular Formula: | C8H4BrNO2 |
| Molecular Weight: | 226.03 |
| InChI: | InChI=1/C8H4BrNO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12) |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Flash Point: | 37 |
| Boiling Point: | 136 |
| Density: | 1.826 g/cm3 |
| Stability: | Stable under normal shipping and handling conditions. |
| Refractive index: | 1.4335 (20 C) |
| Solubility: | Insoluble |
| Appearance: | red crystals |
| Flash Point: | 37 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. Flammables-area. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
