| Identification | |
| Name: | 1,2,3-Trichlorobenzene |
| Synonyms: | 1,2,6-Trichlorobenzene; Trichlorobenzene |
| CAS: | 87-61-6 |
| EINECS: | 201-757-1 |
| Molecular Formula: | C6H3Cl3 |
| Molecular Weight: | 181.45 |
| InChI: | InChI=1/C6H3Cl3/c7-4-2-1-3-5(8)6(4)9/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.69 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.567 |
| Water Solubility: | INSOLUBLE |
| Solubility: | Insoluble. AUTOIGNITION |
| Appearance: | white flakes |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | 0-6°C |
| Color: | Platelets from alcohol White crystals |
| Usage: | Chemical intermediate eg, for 2,3-dichlorophenol, constituent of trichlorobenzene mixt used for termite control former use & as transformer fluid, dye carrier & solvent. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
