| Identification | |
| Name: | 2,6-Dimethylaniline |
| Synonyms: | 2,6-Xylidine; 2,6-Dimethylanilin |
| CAS: | 87-62-7 |
| EINECS: | 201-758-7 |
| Molecular Formula: | C8H11N |
| Molecular Weight: | 121.18 |
| InChI: | InChI=1/C8H11N/c1-6-4-3-5-7(2)8(6)9/h3-5H,9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1711 |
| Density: | 0.9842 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5591-1.5611 |
| Solubility: | Slightly AUTOIGNITION |
| Appearance: | Colorless to reddish yellow liquid |
| Packinggroup: | II |
| HS Code: | 29214910 |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Yellow liquid Colorless to reddish-yellow, clear liquid |
| Usage: | Chemical intermediate for dyes. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
 |
|
