| Identification | |
| Name: | D-Tagatose |
| Synonyms: | Tagatose,D- (8CI);D-lyxo-2-Hexulose; |
| CAS: | 87-81-0 |
| EINECS: | 201-772-3 |
| Molecular Formula: | C6H12O6 |
| Molecular Weight: | 180.15588 |
| InChI: | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5+,6-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.589 g/cm3 |
| Water Solubility: | H2O: 0.1 g/mL, clear, colorless |
| Solubility: | H2O: 0.1 g/mL, clear, colorless |
| Appearance: | White crystalline powder |
| Specification: | white to off-white crystalline powder usageEng:A monosaccharide (hexose) that can be used as a low-calorie sweetener, as an intermediate for synthesis of other optically active compounds, and as an additive in detergent, cosmetic, and pharmaceutical formulation. Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29400000 |
| Usage: | A monosaccharide (hexose) that can be used as a low-calorie sweetener, as an intermediate for synthesis of other optically active compounds, and as an additive in detergent, cosmetic, and pharmaceutical formulation. |
| Safety Data | |
 |
|
