| Identification | |
| Name: | 1-Bromo-3-methyl-2-butene |
| Synonyms: | Isoamylene bromide; 3,3-Dimethyl allyl bromide; PRENYL BROMIDE ; 1-Brom-3-methyl-2-buten(4-2,2) ; 1-bromo-3-methyl-2-buten ; 2-Butene,1-bromo-3-methyl- ; 3,3-Dimethallylbromide ; 3-Methyl-1-bromo-2-butene ; 3-Methyl-2-butyenyl bromide ; 3-Methyl-butenyl bromide ; 3-Methylcrotyl bromide |
| CAS: | 870-63-3 |
| EINECS: | 212-799-5 |
| Molecular Formula: | C5H9Br |
| Molecular Weight: | 149.03 |
| InChI: | InChI=1/C5H9Br/c1-5(2)3-4-6/h3H,4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2920 |
| Melting Point: | 60 C at 60 mm Hg |
| Density: | 1.27 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.489-1.491 |
| Water Solubility: | ? |
| Solubility: | ? |
| Appearance: | Light brown liquid with strong pungent odor |
| Packinggroup: | III |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
