| Identification |
| Name: | Butanoic acid,4,4'-dithiobis[2-amino-, (2R,2'R)-rel- |
| CAS: | 870-93-9 |
| EINECS: | 212-803-5 |
| Molecular Formula: | C8H16N2O4S2 |
| Molecular Weight: | 268.35364 |
| InChI: | InChI=1S/C8H16N2O4S2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.443 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Not hazardous according to Directive 67/548/EEC. Toxicity data (The meaning of any toxico |
| Solubility: | |
| Appearance: | white to slightly beige solid |
| Safety Data |
| |
 |
