| Identification | |
| Name: | 4-Formylphenylboronic acid |
| Synonyms: | Boronic acid, (4-formylphenyl)-;(4-formylphenyl)boronic acid;(4-formylphenyl) Boronic acid;4-Formylphenyl Boronic Acid;4-Formylbenzeneboronic acid;4-(dihydroxyboryl)benzaldehyde; |
| CAS: | 87199-17-5 |
| EINECS: | 438-670-5 |
| Molecular Formula: | C7H7BO3 |
| Molecular Weight: | 149.94 |
| InChI: | InChI=1/C7H7BO3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-5,10-11H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1759 |
| Density: | 1.244 g/cm3 |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powder usageEng:suzuki reaction Safety Statements:22-26-36/37/39-45-37/39-36 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Sensitive: | Air Sensitive |
| Usage: | suzuki reaction |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
