| Identification |
| Name: | 1H-Imidazole,5-chloro-1-methyl- |
| Synonyms: | Imidazole,5-chloro-1-methyl- (7CI,8CI);1-Methyl-5-chloroimidazole;5-Chloro-1-methyl-1H-imidazole; |
| CAS: | 872-49-1 |
| EINECS: | 212-827-6 |
| Molecular Formula: | C4H5ClN2 |
| Molecular Weight: | 116.55 |
| InChI: | InChI=1/C4H5ClN2/c1-7-3-6-2-4(7)5/h2-3H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.25 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.511-1.515 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | White crystalline powder |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | A useful synthetic intermediate |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
