| Identification |
| Name: | Anisonitrile |
| Synonyms: | 4-Methoxybenzonitrile, (p-Anisonitrile); p-Anisonitrile; 4-Methoxybenzonitrile |
| CAS: | 874-90-8 |
| EINECS: | 212-871-6 |
| Molecular Formula: | C8H7NO |
| Molecular Weight: | 133.15 |
| InChI: | InChI=1/C8H7NO/c1-10-8-4-2-7(6-9)3-5-8/h2-5H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3276 |
| Flash Point: | 256-257ºC |
| Density: | 240 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.527 |
| Water Solubility: | soluble |
| Solubility: | Water Solubility :soluble |
| Appearance: | White to off-white crystalline powder. |
| Packinggroup: | III |
| HS Code: | 29269095 |
| Flash Point: | 256-257ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Hygroscopic |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
