Identification |
Name: | 1H-Tetrazole-1-carboxamide,5-([1,1'-biphenyl]-4-ylmethyl)-N,N-dimethyl- |
Synonyms: | LY 2183240 |
CAS: | 874902-19-9 |
Molecular Formula: | C17H17 N5 O |
Molecular Weight: | 307.34978 |
InChI: | InChI=1/C17H17N5O/c1-21(2)17(23)22-16(18-19-20-22)12-13-8-10-15(11-9-13)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Density: | 1.22g/cm3 |
Refractive index: | 1.64 |
Biological Activity: | Novel and highly potent blocker of anandamide uptake (IC 50 = 270 pM). Inhibits fatty acid amide hydrolase (FAAH) activity (IC 50 = 12.4 nM). Following i.p. administration in rats, increases brain anandamide concentration and exerts antinociceptive effects in formalin model of pain. |
Safety Data |
|
 |