Identification |
Name: | 1H-Indole,1,2-dimethyl- |
Synonyms: | Indole,1,2-dimethyl- (7CI,8CI);1,2-Dimethyl-1H-indole;N,2-Dimethylindole;NSC 62087; |
CAS: | 875-79-6 |
EINECS: | 212-877-9 |
Molecular Formula: | C10H11N |
Molecular Weight: | 145.2 |
InChI: | InChI=1/C10H11N/c1-8-7-9-5-3-4-6-10(9)11(8)2/h3-7H,1-2H3 |
Molecular Structure: |
|
Properties |
Transport: | 50kgs |
Flash Point: | 111.3 ºC |
Boiling Point: | 260.5 ºC at 760 mmHg |
Density: | 0.99 g/cm3 |
Stability: | Stable, but light sensitive. Incompatible with strong oxidizing agents. |
Refractive index: | 1.561 |
Solubility: | Appearance:off-white
crystals Transport Information:50kgs Hazard Symbols:Not
regulated UN NO. particular:particular
|
Appearance: | off-white
crystals |
Specification: |
Its extinguishing agent is sand, foam, water mist and carbon dioxide.
|
Flash Point: | 111.3 ºC |
Safety Data |
Hazard Symbols |
|
|
|