| Identification |
| Name: | 4-(Chloromethyl)benzoyl chloride |
| Synonyms: | p-Toluoylchloride, a-chloro- (6CI,7CI,8CI);4-(Chloromethyl)benzoyl chloride; NSC 508741; p-(Chloromethyl)benzoyl chloride;a-Chloro-p-toluoyl chloride |
| CAS: | 876-08-4 |
| EINECS: | 212-881-0 |
| Molecular Formula: | C8H6Cl2O |
| Molecular Weight: | 189.04 |
| InChI: | InChI=1/C8H6Cl2O/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3261 |
| Density: | 1.317 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5700 (20 C) |
| Solubility: | Insoluble |
| Appearance: | Colorless liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Store protected from moisture. |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
