| Identification | |
| Name: | Pyridine,4-(1H-imidazol-5-ylmethyl)- |
| Synonyms: | Pyridine,4-(1H-imidazol-4-ylmethyl)- (9CI); Immethridine |
| CAS: | 87976-03-2 |
| Molecular Formula: | C9H9 N3 |
| Molecular Weight: | 159.19 |
| InChI: | InChI=1/C9H9N3/c1-3-10-4-2-8(1)5-9-6-11-7-12-9/h1-4,6-7H,5H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 198.515°C |
| Boiling Point: | 402.455°C at 760 mmHg |
| Density: | 1.191g/cm3 |
| Refractive index: | 1.608 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Biological Activity: | Potent and highly selective histamine H 3 receptor agonist (pEC 50 = 9.74) that displays 300-fold selectivity over the H 4 receptor (pK i values are 9.07 and 6.61 respectively). Does not bind to H 1 or H 2 receptors at concentrations up to 10 μ M. |
| Flash Point: | 198.515°C |
| Storage Temperature: | Desiccate at RT |
| Color: | off-white |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
