| Identification |
| Name: | 4-Chloro-3,5-dimethylphenol |
| Synonyms: | 4-Chloro-3,5-xylenol; PCMX; 4-Chloro-3,5-xylenol (OH=1); 5-M-Xylenol (Chloroxylenol); 4-Chloro-3,5-m-Xylenol; p-chloro-m-xylenol; 4-chloro-m-xylenol; 3,5-xylenol, 4-chloro-; 4-chloro-1-hydroxy-3,5-dimethylbenzene; 4-chloro-3,5-dimethyl-phenol; 4-chloro-3-xylenol |
| CAS: | 88-04-0 |
| EINECS: | 201-793-8 |
| Molecular Formula: | C8H9ClO |
| Molecular Weight: | 156.61 |
| InChI: | InChI=1/C8H9ClO/c1-5-3-7(10)4-6(2)8(5)9/h3-4,10H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3077 |
| Density: | 1.183 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.558 |
| Solubility: | Slightly soluble |
| Appearance: | white to off-white crystalline powder |
| HS Code: | 29081000 |
| Color: | Crystals from benzene |
| Usage: | Antiseptic and germicide. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |