| Identification |
| Name: | 2, 4, 6-Trichlorophenol |
| Synonyms: | 2,4,6-Trichloro-2-hydroxybenzene; 2,4,6-TCP; 2,4,6-TRICHLOROPHENOL; DOWICIDE 2S; DOWICIDE 2S(R); PHENACHLOR; OMAL; TRICHLOROPHENOL(2,4,6-); 2,4,6-TRICHLORO PHENOL |
| CAS: | 88-06-2 |
| EINECS: | 201-795-9 |
| Molecular Formula: | C6H3Cl3O |
| Molecular Weight: | 197.45 |
| InChI: | InChI=1/C6H3Cl3O/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2020 |
| Density: | 1.49 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.608 |
| Water Solubility: | 0.8 g/L |
| Solubility: | SOLVENT |
| Appearance: | white to off-white crystalline solid |
| Packinggroup: | III |
| HS Code: | 29081000 |
| Storage Temperature: | 0-6°C |
| Color: | white to slightly brown |
| Usage: | Herbicide, defoliant, fungicide former uses. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
| |
 |
