| Identification | |
| Name: | 3-Thiophenezoic acid |
| Synonyms: | 3-Carboxythiophene;3-Thenoic acid;3-Thienylcarboxylic acid;NSC 66314;b-Thiophenic acid;b-Thiophenecarboxylic acid; |
| CAS: | 88-13-1 |
| EINECS: | 201-802-5 |
| Molecular Formula: | C5H4O2S |
| Molecular Weight: | 128.14 |
| InChI: | InChI=1/C5H4O2S/c6-5(7)4-1-2-8-3-4/h1-3H,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 117.8 oC |
| Boiling Point: | 271.1oC |
| Density: | 1.401 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.606 |
| Solubility: | SOLVENT |
| Appearance: | white to off-white flake |
| Specification: |
??3-Thiophenezoic acid ,?its cas register number is 88-13-1. It also can be called?3-Thenoic acid ; 3-Thienylcarboxylic acid ;? |
| HS Code: | 29349990 |
| Flash Point: | 117.8 oC |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
 |
|
