| Identification |
| Name: | 2-Furoic acid |
| Synonyms: | Furan-2-carboxylic acid; 2-Furoic acid, (Furan-2-carboxylic acid); pyromucic acid |
| CAS: | 88-14-2 |
| EINECS: | 201-803-0 |
| Molecular Formula: | C5H4O3 |
| Molecular Weight: | 112.08 |
| InChI: | InChI=1/C5H4O3/c6-5(7)4-2-1-3-8-4/h1-3H,(H,6,7) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 8 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.531(lit.) |
| Water Solubility: | 36 g/L (20 oC) in water |
| Solubility: | 36 g/L (20 oC) in water |
| Appearance: | white to light yellow crystal powde |
| HS Code: | 29321900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
