| Identification |
| Name: | 2-Iodobenzoic acid |
| Synonyms: | ACID O-IODOBENZOIC |
| CAS: | 88-67-5 |
| EINECS: | 201-850-7 |
| Molecular Formula: | C7H5IO2 |
| Molecular Weight: | 248.02 |
| InChI: | InChI=1/C7H5IO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10) |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Density: | 2.25 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Water Solubility: | sparingly soluble |
| Solubility: | sparingly soluble in water |
| Appearance: | white to off-white crystals |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
