| Identification | |
| Name: | 1,2-Benzenedicarboxamide |
| Synonyms: | Phthalamide(6CI,7CI,8CI);NSC 5512;Phthalic acid diamide;o-Carbamoylbenzamide; |
| CAS: | 88-96-0 |
| EINECS: | 201-870-6 |
| Molecular Formula: | C8H8N2O2 |
| Molecular Weight: | 164.16 |
| InChI: | InChI=1/C8H8N2O2/c9-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H,(H2,9,11)(H2,10,12) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 223°C (dec.) |
| Flash Point: | 214.4°C |
| Boiling Point: | 430.8°C at 760 mmHg |
| Density: | 1.294g/cm3 |
| Stability: | Stable. Incompatible with acids, strong oxidizing agents. |
| Refractive index: | 1.612 |
| Water Solubility: | negligible Stability Stable. Incompatible with acids, strong oxidizing agents. Toxicology May be harmful or act as an irritant - toxicology not fully investigated. Toxicity data |
| Solubility: | negligible
|
| Appearance: | colourless crystals or white crystalline powder |
| Report: |
Reported in EPA TSCA Inventory. NTP Carcinogenesis Bioassay (feed): No Evidence: mouse, rat NCITR* National Cancer Institute Carcinogenesis Technical Report Series. (Bethesda, MD 20014) No. NCI-TR-161 (1979). . |
| Flash Point: | 214.4°C |
| Safety Data | |
 |
|
