| Identification |
| Name: | 1,2-Pyrrolidinedicarboxylicacid, 4-hydroxy-, 1-(9H-fluoren-9-ylmethyl) ester, (2S,4R)- |
| Synonyms: | 1,2-Pyrrolidinedicarboxylicacid, 4-hydroxy-, 1-(9H-fluoren-9-ylmethyl) ester, (2S-trans)-;N-Fmoc-trans-4-hydroxy-L-proline; |
| CAS: | 88050-17-3 |
| Molecular Formula: | C20H19NO5 |
| Molecular Weight: | 353.37 |
| InChI: | InChI=1/C20H19NO5/c22-12-9-18(19(23)24)21(10-12)20(25)26-11-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,12,17-18,22H,9-11H2,(H,23,24)/t12-,18+/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Flash Point: | 314°C |
| Boiling Point: | 595.5°C at 760 mmHg |
| Density: | 1.407g/cm3 |
| Refractive index: | 1.658 |
| Solubility: |
Appearance:White to off-white crystalline powder Transport Information: OTH Hazard Symbols:Not regulated
UN
NO. particular:particular
|
| Appearance: | White to off-white crystalline powder |
| Flash Point: | 314°C |
| Storage Temperature: | 2-8°C |
| Safety Data |
| Hazard Symbols |
|
| |
 |