| Identification | |
| Name: | Pyridine,2-chloro-3-fluoro-4-methyl- |
| Synonyms: | 2-Chloro-3-fluoro-4-picoline; |
| CAS: | 881891-82-3 |
| Molecular Formula: | C6H5ClFN |
| Molecular Weight: | 145.56 |
| InChI: | InChI=1/C6H5ClFN/c1-4-2-3-9-6(7)5(4)8/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 186.4 ºC at 760 mmHg |
| Boiling Point: | 186.4 ºC at 760 mmHg |
| Density: | 1.264 g/cm3 |
| Refractive index: | 1.503 |
| Specification: |
The 2-Chloro-3-fluoro-4-methylpyridine, with its CAS registry number 881891-82-3, has the systematic name of Pyridine, 2-chloro-3-fluoro-4-methyl-. And its product category is including Pyridine. The characteristics of 2-Chloro-3-fluoro-4-methylpyridine are as follows: (1)ACD/LogP: 2.01; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.01; (4)ACD/LogD (pH 7.4): 2.01 ; (5)#H bond acceptors: 1; (6)#H bond donors: 0; (7)#Freely Rotating Bonds: 0; (8)Polar Surface Area: 12.89 ; (9)Index of Refraction: 1.503; (10)Molar Refractivity: 34.05 cm3; (11)Molar Volume: 115 cm3; (12)Polarizability: 13.5×10-24 cm3; (13)Surface Tension: 36 dyne/cm; (14)Density: 1.264 g/cm3; (15)Flash Point: 66.5 °C; (16)Enthalpy of Vaporization: 40.53 kJ/mol; (17)Boiling Point: 186.4 °C at 760 mmHg; (18)Vapour Pressure: 0.913 mmHg at 25°C. What's more, the following datas could be converted into the molecular structure: |
| Flash Point: | 186.4 ºC at 760 mmHg |
| Safety Data | |
 |
|
