| Identification | |
| Name: | 3-Pyridinecarboxaldehyde,5-chloro-2-fluoro- |
| Synonyms: | 5-Chloro-2-fluoropyridine-3-carboxaldehyde; |
| CAS: | 882679-90-5 |
| Molecular Formula: | C6H3ClFNO |
| Molecular Weight: | 159.55 |
| InChI: | InChI=1/C6H3ClFNO/c7-5-1-4(3-10)6(8)9-2-5/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.444 |
| Refractive index: | 1.565 |
| Specification: | usageEng:Used in the preparation of trisubstituted amine compounds as CETP inhibitors useful in the treatment of arteriosclerotic diseases, hyperlipemia, dyslipidemia and related diseases. |
| Storage Temperature: | Room temperature. |
| Usage: | Used in the preparation of trisubstituted amine compounds as CETP inhibitors useful in the treatment of arteriosclerotic diseases, hyperlipemia, dyslipidemia and related diseases. |
| Safety Data | |
 |
|
