| Identification | |
| Name: | 2(3H)-Benzoxazolone,7-amino-5-chloro- |
| Synonyms: | 7-Amino-5-chloro-2(3H)-benzoxazolone |
| CAS: | 889884-60-0 |
| Molecular Formula: | C7H5 Cl N2 O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H5ClN2O2/c8-3-1-4(9)6-5(2-3)10-7(11)12-6/h1-2H,9H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | >220?C (dec.) |
| Density: | 1.586g/cm3 |
| Refractive index: | 1.669 |
| Specification: | Tan Solid usageEng:An intermediate in the synthesis of Bifeprunox, which is used as an antipsychotic compound. |
| Storage Temperature: | Refrigerator |
| Usage: | An intermediate in the synthesis of Bifeprunox, which is used as an antipsychotic compound. |
| Safety Data | |
 |
|
