| Identification | |
| Name: | 2,3-Pyridinedicarboxylic acid |
| Synonyms: | Pyridine-2,3-dicarboxylate; Pyridine-2,3-dicarboxylic acid; Quinolinic Acid; AKOS BBS-00003814; AKOS AUF2085; RARECHEM AL BO 0810; QUINOLIC ACID; 2,3-pyridine dicarboxylic acid |
| CAS: | 89-00-9 |
| EINECS: | 201-874-8 |
| Molecular Formula: | C7H5NO4 |
| Molecular Weight: | 167.12 |
| InChI: | InChI=1/C7H5NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.551 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | 0.55 g/100 mL |
| Solubility: | 0.55 g/100 mL in water |
| Appearance: | White solid. |
| Specification: |
? Quinolinic acid , with CAS number of 89-00-9, can be called pyridine-2,3-carboxylate ; 2,3-Pyridinedicarboxylic acid, copper(2+) salt (1:1) ; 2,3-pyridinedicarboxylic acid ; Quinolinate ; 2,3-pyridinedicarboxylate ; 2, 3-Pyridinedicarboxylic acid ; pyridine-2,3-dicarboxylate; strontium(+2) cation ; 2,3-Pyridinedicarboxylic acid, strontium salt ; pyridine-2,3-dicarboxylic acid ; Pyridine-2,3-DicarboxylicI acid 99% ; 2,3-pyridine dicarboxylic acid ; Quinolinic Acid 99% . |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29333999 |
| Biological Activity: | Endogenous NMDA agonist and transmitter candidate. May distinguish between NMDA receptor subtypes. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Crystals Monoclinic crystals from water |
| Usage: | Inhibits glucose synthesis |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
