| Identification |
| Name: | 1,2-Benzenedicarboxylicacid, 1,2-bis(8-methylnonyl) ester |
| Synonyms: | 1,2-Benzenedicarboxylicacid, bis(8-methylnonyl) ester (9CI);Phthalic acid, bis(8-methylnonyl) ester (8CI); |
| CAS: | 89-16-7 |
| EINECS: | 201-884-2 |
| Molecular Formula: | C28H46O4 |
| Molecular Weight: | 446.667 |
| InChI: | InChI=1/C28H46O4/c1-23(2)17-11-7-5-9-15-21-31-27(29)25-19-13-14-20-26(25)28(30)32-22-16-10-6-8-12-18-24(3)4/h13-14,19-20,23-24H,5-12,15-18,21-22H2,1-4H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | -50 deg C |
| Density: | 0.964g/cm3 |
| Solubility: | Insol in glycerol, glycols and some amines; sol in most organic solvents More soluble in crude sweat than in water and increasing solubility with pH rise In water, 0.28 mg/L at 25 deg C |
| Color: | Clear liquid |
| Safety Data |
| |
 |