| Identification | |
| Name: | 1,2,4,5-Benzenetetracarboxylic anhydride |
| Synonyms: | Pyromellitic dianhydride; 1,2,4,5-Benzenetetracarboxylic dianhydride; benzene-1,2:4,5-tetracarboxylic dianhydride; PMDA |
| CAS: | 89-32-7 |
| EINECS: | 201-898-9 |
| Molecular Formula: | C10H2O6 |
| Molecular Weight: | 218.12 |
| InChI: | InChI=1/C10H2O6/c11-7-3-1-4-6(10(14)16-8(4)12)2-5(3)9(13)15-7/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.68 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.708 |
| Water Solubility: | decomposes |
| Solubility: | Decomposes with water AUTOIGNITION |
| Appearance: | White powder |
| HS Code: | 29173980 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Moisture Sensitive |
| Color: | White powder |
| Usage: | Pyromellitic dianhydride (PMDA) is employed as a curing agent for epoxy agent resins used for casting, laminating, the manufacture of moulding powders, adhesives and coatings. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
