| Identification |
| Name: | Benzoic acid,2-hydroxy-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, rel- |
| Synonyms: | Benzoicacid, 2-hydroxy-, 5-methyl-2-(1-methylethyl)cyclohexyl ester, (1a,2b,5a)-; Salicylic acid, p-menth-3-yl ester (6CI,7CI,8CI); Menthol, salicylate;Contrasol; Menthyl salicylate; Salimenthol; Samol; Sunburn preventive No. 1 |
| CAS: | 89-46-3 |
| EINECS: | 201-909-7 |
| Molecular Formula: | C17H24 O3 |
| Molecular Weight: | 276.37 |
| InChI: | InChI=1/C17H24O3/c1-11(2)13-9-8-12(3)10-16(13)20-17(19)14-6-4-5-7-15(14)18/h4-7,11-13,16,18H,8-10H2,1-3H3/t12-,13+,16-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Refractive index: | n20/D 1.52 |
| Appearance: | colourless to light yellow liquid |
| Safety Data |
| |
 |