| Identification |
| Name: | Cyclohexanol,5-methyl-2-(1-methylethyl)-, 1-acetate, (1R,2S,5R)-rel- |
| CAS: | 89-48-5 |
| EINECS: | 201-911-8 |
| Molecular Formula: | C12H22O2 |
| Molecular Weight: | 198.3019 |
| InChI: | InChI=1S/C12H22O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h8-9,11-12H,5-7H2,1-4H3/t9-,11+,12-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 37 - 38 |
| Flash Point: | 198 ºF |
| Boiling Point: | 228-229 ºC |
| Density: | 0.922 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.447 |
| Solubility: | Insoluble |
| Flash Point: | 198 ºF |
| Storage Temperature: | Keep tightly closed. Keep away from heat and open flame. Store in a cool dry place. |
| Usage: | Substance is used in as an aroma for perfumes. |
| Safety Data |
| |
 |