| Identification |
| Name: | 5-Aminosalicylic acid |
| Synonyms: | 5-Amino-2-hydroxybenzoic acid; Mesalamine; 5-ASA; 5-Amino salicylic acidl; Mesalazine; Mesalmine; mesalazine; 5-Amino salicylic Acid |
| CAS: | 89-57-6 |
| EINECS: | 201-919-1 |
| Molecular Formula: | C7H7NO3 |
| Molecular Weight: | 153.14 |
| InChI: | InChI=1/C7H7NO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,8H2,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 403.9oC at 760 mmHg |
| Boiling Point: | 403.9oC at 760 mmHg |
| Density: | 1.491 g/cm3 |
| Stability: | Stable. Incompatible with acids, acid anhydrides, acid chlorides, chloroformates, strong oxidizing agents. |
| Water Solubility: | | <0.1 g/100 mL at 21 ºC |
| Solubility: | Very soluble |
| Appearance: | White to off-white powder |
| Report: |
Reported in EPA TSCA Inventory.
|
| HS Code: | 29225000 |
| Flash Point: | 403.9oC at 760 mmHg |
| Color: | off-white to gray |
| Usage: | The active metabolite of Sulfasalazine. Anti-inflammatory (gastrointestinal) |
| Safety Data |
| |
 |