| Identification | ||
| Name: | 5-Aminosalicylic acid | |
| Synonyms: | 5-Amino-2-hydroxybenzoic acid; Mesalamine; 5-ASA; 5-Amino salicylic acidl; Mesalazine; Mesalmine; mesalazine; 5-Amino salicylic Acid | |
| CAS: | 89-57-6 | |
| EINECS: | 201-919-1 | |
| Molecular Formula: | C7H7NO3 | |
| Molecular Weight: | 153.14 | |
| InChI: | InChI=1/C7H7NO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,8H2,(H,10,11) | |
| Molecular Structure: |  |
|
| Properties | ||
| Flash Point: | 403.9oC at 760 mmHg | |
| Boiling Point: | 403.9oC at 760 mmHg | |
| Density: | 1.491 g/cm3 | |
| Stability: | Stable. Incompatible with acids, acid anhydrides, acid chlorides, chloroformates, strong oxidizing agents. | |
| Water Solubility: | <0.1 g/100 mL at 21 ºC | |
| Solubility: | Very soluble | |
| Appearance: | White to off-white powder | |
| Report: |
Reported in EPA TSCA Inventory. | |
| HS Code: | 29225000 | |
| Flash Point: | 403.9oC at 760 mmHg | |
| Color: | off-white to gray | |
| Usage: | The active metabolite of Sulfasalazine. Anti-inflammatory (gastrointestinal) | |
| Safety Data | ||
 |
||
