| Identification | |
| Name: | D-Isoascorbic acid |
| Synonyms: | D-erythro-Hexonicacid, 3-keto-, g-lactone(6CI);Erythorbic acid (7CI);Araboascorbic acid;Araboascorbic acid, D-;D-(-)-Isoascorbic acid;D-Araboascorbic acid;D-Erythorbic acid;D-arabino-Ascorbic acid;E 315;Erycorbin;Glucosaccharonic acid;Isoascorbic acid;Isovitamin C;Mercate 5;Neo-Cebicure;Saccharosonic acid;Erythorbic acid; |
| CAS: | 89-65-6 |
| EINECS: | 201-928-0 |
| Molecular Formula: | C6H8O6 |
| Molecular Weight: | 176.12 |
| InChI: | InChI=1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.954 g/cm3 |
| Stability: | Stable. Combustible. Incompatible with chemically active metals, aluminium, zinc, copper, magnesium, strong bases, strong oxidizing agents. |
| Alpha: | -17.25 o (C=10, H2O 25 oC) |
| Water Solubility: | 1g/10mL |
| Solubility: | 0.1 g/mL in water |
| Appearance: | Crystalline |
| Specification: |
? D-Isoascorbic acid , with CAS number of 89-65-6, can be called D-erythro-Hexonicacid, 3-keto-, g-lactone(6CI) ; Araboascorbic acid ; Araboascorbic acid, D- ; D-(-)-Isoascorbic acid ; D-Araboascorbic acid ; D-Erythorbic acid ; Glucosaccharonic acid ; Saccharosonic acid . |
| Report: |
Reported in EPA TSCA Inventory. |
| Usage: | Antioxidant especially in brewing industry, reducing agent in photography. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
