| Identification | |
| Name: | Benzoic acid,2-methyl-, methyl ester |
| Synonyms: | o-Toluicacid, methyl ester (6CI,7CI,8CI);2-Methylbenzoic acid methyl ester;2-Toluicacid methyl ester;Methyl 2-methylbenzoate;Methyl 2-toluate;Methylo-methylbenzoate;Methyl orthotoluate;NSC 9402; |
| CAS: | 89-71-4 |
| EINECS: | 201-932-2 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.18 |
| InChI: | InChI=1/C9H10O2/c1-7-5-3-4-6-8(7)9(10)11-2/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -50 |
| Flash Point: | 82 °C |
| Density: | 1.073 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.518-1.52 |
| Solubility: | Insoluble |
| Appearance: | Colorless liquid. Toluene-like odor. |
| Specification: | clear colorless liquid Safety Statements:37/39-26-36 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 82 °C |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
