| Identification | |
| Name: | 2-sec-Butylphenol |
| Synonyms: | Butylphenol |
| CAS: | 89-72-5 |
| EINECS: | 201-933-8 |
| Molecular Formula: | C10H14O |
| Molecular Weight: | 150.22 |
| InChI: | InChI=1/C10H14O/c1-3-8(2)9-6-4-5-7-10(9)11/h4-8,11H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2228/3145 |
| Density: | 0.9804 |
| Stability: | Stable, but air sensitive. Incompatible with acid chlorides, acid anhydrides, bases, strong oxidizing agents, copper and its alloys, brass. |
| Refractive index: | 1.521-1.523 |
| Water Solubility: | Insoluble. |
| Solubility: | Insoluble. <0.1 g/100 mL at 20 ºC |
| Appearance: | colourless to light yellow liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Color: | LIQUID Amber-colored liquid Colorless liquid or solid (below 61 degrees F). |
| Usage: | Chemical intermediate in prepn of resins, plasticizers, surface active agents & other products. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
