| Identification | |
| Name: | 2-Chlorobenzaldehyde |
| Synonyms: | 2 chloro benzaldehyde; O-chlorobenzenecarboxyaldehyde; ortho-chlorobenzaldehyde; OCAD; OCBA; 2-Chlorobenzophenone; o-Chlorobenzophenone; O-CHLOROBENZALDEHYDE; 2-Chlorobenzophenone |
| CAS: | 89-98-5 |
| EINECS: | 201-956-3 |
| Molecular Formula: | C7H5ClO |
| Molecular Weight: | 140.57 |
| InChI: | InChI=1/C7H5ClO/c8-7-4-2-1-3-6(7)5-9/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.248 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases, iron, strong reducing agents. Moisture and light-sensitive. |
| Refractive index: | 1.565-1.567 |
| Solubility: | negligible SOLVENT |
| Appearance: | colorless to pale yellow liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29130000 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Do not expose to air. Store protected from moisture. Store under an inert atmosphere. |
| Sensitive: | Air Sensitive |
| Color: | COLORLESS TO YELLOWISH LIQ |
| Usage: | Synth of alcohols, acids, in rubber, tanning, & paper industries & in agriculture. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
