| Identification | |
| Name: | Boronic acid,B-1-cyclohexen-1-yl- |
| Synonyms: | 1-Cyclohexene-1-boronicacid (7CI);1-Cyclohexenylboronic acid;Cyclohexenylboronic acid;Boronic acid, 1-cyclohexen-1-yl- (9CI); |
| CAS: | 89490-05-1 |
| Molecular Formula: | C6H11BO2 |
| Molecular Weight: | 125.96 |
| InChI: | InChI=1/C6H11BO2/c8-7(9)6-4-2-1-3-5-6/h4,8-9H,1-3,5H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 165°C |
| Density: | 1.05g/cm3 |
| Refractive index: | 1.48 |
| Specification: |
1-Cyclohexen-1-ylboronic acid , its cas register number is 89490-05-1. It also can be called boronic acid, B-1-cyclohexen-1-yl- ; and Cyclohex-1-en-1-ylboronic acid . |
| Storage Temperature: | Keep Cold |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
