| Identification | |
| Name: | Benzenemethanol,2-hydroxy- |
| Synonyms: | Benzylalcohol, o-hydroxy- (8CI);1-(o-Hydroxyphenyl)methanol;2-Hydroxybenzenemethanol;2-Hydroxymethylphenol;2-Methylolphenol;Diathesin;NSC 3814;Salicyl alcohol;Salicylicalcohol;Saligenin;Saligenol;o-(Hydroxymethyl)phenol;o-Hydroxybenzylalcohol;o-Methylolphenol;a,2-Dihydroxytoluene;a-Hydroxy-o-cresol; |
| CAS: | 90-01-7 |
| EINECS: | 201-960-5 |
| Molecular Formula: | C7H8O2 |
| Molecular Weight: | 124.14 |
| InChI: | InChI=1/C7H8O2/c8-5-6-3-1-2-4-7(6)9/h1-4,8-9H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.61 |
| Stability: | Stable. Incompatible with acids, acid chlorides, acid anhydrides, strong oxidizing agents. |
| Refractive index: | 1.595 |
| Solubility: | 67 g/L (22 oC) |
| Appearance: | light brown crystalline powder |
| Specification: | light brown crystalline powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29072900 |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
