| Identification | |
| Name: | Guaiacol |
| Synonyms: | Phenol,o-methoxy- (8CI);1-Hydroxy-2-methoxybenzene;2-Hydroxyanisole;2-Methoxyphenol;Anastil;Guaiastil;Methylcatechol;Phenol,2-methoxy-;O-Methyl catechol;Pyrocatechol monomethyl ether;Pyroguaiac acid;o-Guaiacol;o-Hydroxyanisole;o-Methoxyphenol;Guaiacol (JAN); |
| CAS: | 90-05-1 |
| EINECS: | 201-964-7 |
| Molecular Formula: | C7H8O2 |
| Molecular Weight: | 124.13 |
| InChI: | InChI=1/C7H8O2/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.12 |
| Stability: | Stable, but air and light sensitive. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.543-1.545 |
| Solubility: | Slightly soluble |
| Appearance: | off-white crystals |
| Specification: |
?Guaiacol (CAS NO.90-05-1), its Synonyms are o-Methoxyphenol ; 1-Hydroxy-2-methoxybenzene ; 2-Hydroxyanisole ; 2-Methoxyphenol ; Guaiastil ; Guaicol ; Guaicolina ; Guajacol ; Phenol, 2-methoxy- ; Phenol, o-methoxy- ; Propenylguaiacol ; Pyrocatechol methyl ester ; Pyrocatechol monomethyl ether ; Pyroguaiac acid . It is colorless to amber crystals or liquid. |
| Packinggroup: | II |
| HS Code: | 29095010 |
| Storage Temperature: | Refrigerator |
| Sensitive: | Air Sensitive |
| Color: | Faintly yellowish, limpid, oily liquid or yellow crystals White or slightly yellow crystalline mass or colorless to yellowish, very refractive liquid Hexagonal prisms |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
