| Identification | |
| Name: | 1-Methylnaphthalene |
| CAS: | 90-12-0 |
| EINECS: | 201-966-8 |
| Molecular Formula: | C11H10 |
| Molecular Weight: | 142.2 |
| InChI: | InChI=1/C11H10/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 |
| Density: | 1.025 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, oxygen. |
| Refractive index: | 1.613-1.616 |
| Solubility: | 0.026 g/L (25 oC) |
| Appearance: | ear colorless to light yellow liquid |
| Specification: | liquid Safety Statements:7-26-36/37/39-61-45-36/37-23-36 7:Keep container tightly closed 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 61:Avoid release to the environment. Refer to special instructions safety data sheet 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 36:Wear suitable protective clothing |
| Packinggroup: | III |
| HS Code: | 29029080 |
| Storage Temperature: | 2-8°C |
| Color: | Colorless liquid or oil |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
