Identification |
Name: | 1-Methylnaphthalene |
CAS: | 90-12-0 |
EINECS: | 201-966-8 |
Molecular Formula: | C11H10 |
Molecular Weight: | 142.2 |
InChI: | InChI=1/C11H10/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-8H,1H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 3082 |
Density: | 1.025 |
Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, oxygen. |
Refractive index: | 1.613-1.616 |
Solubility: | 0.026 g/L (25 oC) |
Appearance: | ear colorless to light yellow liquid |
Specification: | liquid Safety Statements:7-26-36/37/39-61-45-36/37-23-36 7:Keep container tightly closed 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 61:Avoid release to the environment. Refer to special instructions
safety data sheet 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves 23:Do not breathe gas/fumes/vapor/spray (appropriate wording
to be specified by the manufacturer) 36:Wear suitable protective clothing |
Packinggroup: | III |
HS Code: | 29029080 |
Storage Temperature: | 2-8°C |
Color: | Colorless liquid or oil |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|