| Identification | |
| Name: | Naphthalene, 1-iodo- |
| Synonyms: | 1-Iodonaphthalene;1-Naphthyl iodide; NSC 9275; Naphthalen-1-yl iodide; a-Iodonaphthalene; a-Naphthyl iodide |
| CAS: | 90-14-2 |
| EINECS: | 201-968-9 |
| Molecular Formula: | C10H7 I |
| Molecular Weight: | 254.07 |
| InChI: | InChI=1/C10H7I/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 4°C |
| Flash Point: | 138.4°C |
| Density: | 1.74 |
| Refractive index: | 1.698-1.704 |
| Specification: |
Naphthalene, 1-iodo- , its cas register number is 90-14-2. It also can be called 1-Iodonaphthalene ; 1-Naphthyl iodide ; alpha-Iodonaphthalene .It is a clear yellow to brown liquid. |
| HS Code: | 29036990 |
| Flash Point: | 138.4°C |
| Sensitive: | Light Sensitive |
| Color: | clear very deep brown-yellow |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
